C13H19F2NSi — CID 164682511
(5S)-1-[(2,6-difluorophenyl)methyl]-3,3,5-trimethyl-1,3-azasilolidine (PubChem CID 164682511) has the molecular formula C13H19F2NSi and a molecular weight of 255.38 g/mol. Its IUPAC name is (5S)-1-[(2,6-difluorophenyl)methyl]-3,3,5-trimethyl-1,3-azasilolidine.
| Compound Name | (5S)-1-[(2,6-difluorophenyl)methyl]-3,3,5-trimethyl-1,3-azasilolidine |
|---|---|
| PubChem CID | 164682511 |
| Molecular Formula | C13H19F2NSi |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | (5S)-1-[(2,6-difluorophenyl)methyl]-3,3,5-trimethyl-1,3-azasilolidine |
| SMILES | C[C@H]1C[Si](C)(C)CN1Cc1c(F)cccc1F |
| InChI | InChI=1S/C13H19F2NSi/c1-10-8-17(2,3)9-16(10)7-11-12(14)5-4-6-13(11)15/h4-6,10H,7-9H2,1-3H3/t10-/m0/s1 |
| InChIKey | AWPKBHOREVCFEQ-JTQLQIEISA-N |
| XLogP | 3.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|