C24H36ClNOSi — CID 11742732
(2S)-N,N-dibenzyl-4-[tert-butyl(dimethyl)silyl]oxy-1-chlorobutan-2-amine (PubChem CID 11742732) has the molecular formula C24H36ClNOSi and a molecular weight of 418.10 g/mol. Its IUPAC name is (2S)-N,N-dibenzyl-4-[tert-butyl(dimethyl)silyl]oxy-1-chlorobutan-2-amine.
| Compound Name | (2S)-N,N-dibenzyl-4-[tert-butyl(dimethyl)silyl]oxy-1-chlorobutan-2-amine |
|---|---|
| PubChem CID | 11742732 |
| Molecular Formula | C24H36ClNOSi |
| Molecular Weight | 418.10 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | (2S)-N,N-dibenzyl-4-[tert-butyl(dimethyl)silyl]oxy-1-chlorobutan-2-amine |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@H](CCl)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H36ClNOSi/c1-24(2,3)28(4,5)27-17-16-23(18-25)26(19-21-12-8-6-9-13-21)20-22-14-10-7-11-15-22/h6-15,23H,16-20H2,1-5H3/t23-/m0/s1 |
| InChIKey | ALAYFHKFUQPHBH-QHCPKHFHSA-N |
| XLogP | 6.71 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.10 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|