C21H36ClNO2Si — CID 23583352
(2S)-2-[benzyl-[(E)-4-chloro-3-methylbut-2-enyl]amino]-3-[tert-butyl(dimethyl)silyl]oxypropan-1-ol (PubChem CID 23583352) has the molecular formula C21H36ClNO2Si and a molecular weight of 398.06 g/mol. Its IUPAC name is (2S)-2-[benzyl-[(E)-4-chloro-3-methylbut-2-enyl]amino]-3-[tert-butyl(dimethyl)silyl]oxypropan-1-ol.
| Compound Name | (2S)-2-[benzyl-[(E)-4-chloro-3-methylbut-2-enyl]amino]-3-[tert-butyl(dimethyl)silyl]oxypropan-1-ol |
|---|---|
| PubChem CID | 23583352 |
| Molecular Formula | C21H36ClNO2Si |
| Molecular Weight | 398.06 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | (2S)-2-[benzyl-[(E)-4-chloro-3-methylbut-2-enyl]amino]-3-[tert-butyl(dimethyl)silyl]oxypropan-1-ol |
| SMILES | C/C(=C\CN(Cc1ccccc1)[C@@H](CO)CO[Si](C)(C)C(C)(C)C)CCl |
| InChI | InChI=1S/C21H36ClNO2Si/c1-18(14-22)12-13-23(15-19-10-8-7-9-11-19)20(16-24)17-25-26(5,6)21(2,3)4/h7-12,20,24H,13-17H2,1-6H3/b18-12+/t20-/m0/s1 |
| InChIKey | QJIHRFLQHRGVSJ-YWFITGJYSA-N |
| XLogP | 5.06 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.06 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|