C14H28ClNO — CID 107156793
N-(2-chloro-4,4-dimethylpentyl)heptanamide (PubChem CID 107156793) has the molecular formula C14H28ClNO and a molecular weight of 261.84 g/mol. Its IUPAC name is N-(2-chloro-4,4-dimethylpentyl)heptanamide.
| Compound Name | N-(2-chloro-4,4-dimethylpentyl)heptanamide |
|---|---|
| PubChem CID | 107156793 |
| Molecular Formula | C14H28ClNO |
| Molecular Weight | 261.84 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | N-(2-chloro-4,4-dimethylpentyl)heptanamide |
| SMILES | CCCCCCC(=O)NCC(Cl)CC(C)(C)C |
| InChI | InChI=1S/C14H28ClNO/c1-5-6-7-8-9-13(17)16-11-12(15)10-14(2,3)4/h12H,5-11H2,1-4H3,(H,16,17) |
| InChIKey | UMCODGPSTILCHA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.84 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|