C12H24ClNO2 — CID 107156914
N-(2-chloro-4,4-dimethylpentyl)-2-propan-2-yloxyacetamide (PubChem CID 107156914) has the molecular formula C12H24ClNO2 and a molecular weight of 249.78 g/mol. Its IUPAC name is N-(2-chloro-4,4-dimethylpentyl)-2-propan-2-yloxyacetamide.
| Compound Name | N-(2-chloro-4,4-dimethylpentyl)-2-propan-2-yloxyacetamide |
|---|---|
| PubChem CID | 107156914 |
| Molecular Formula | C12H24ClNO2 |
| Molecular Weight | 249.78 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | N-(2-chloro-4,4-dimethylpentyl)-2-propan-2-yloxyacetamide |
| SMILES | CC(C)OCC(=O)NCC(Cl)CC(C)(C)C |
| InChI | InChI=1S/C12H24ClNO2/c1-9(2)16-8-11(15)14-7-10(13)6-12(3,4)5/h9-10H,6-8H2,1-5H3,(H,14,15) |
| InChIKey | KMRGUJWCKCASST-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.78 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|