About N-(2-chloro-4,4-dimethylpentyl)-2-propan-2-yloxyacetamide
N-(2-chloro-4,4-dimethylpentyl)-2-propan-2-yloxyacetamide (PubChem CID 107156914) has the molecular formula C12H24ClNO2
and a molecular weight of 249.78 g/mol. Its IUPAC name is N-(2-chloro-4,4-dimethylpentyl)-2-propan-2-yloxyacetamide.
Molecular Properties
| Compound Name | N-(2-chloro-4,4-dimethylpentyl)-2-propan-2-yloxyacetamide |
| PubChem CID | 107156914 |
| Molecular Formula | C12H24ClNO2 |
| Molecular Weight | 249.78 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | N-(2-chloro-4,4-dimethylpentyl)-2-propan-2-yloxyacetamide |
| SMILES | CC(C)OCC(=O)NCC(Cl)CC(C)(C)C |
| InChI | InChI=1S/C12H24ClNO2/c1-9(2)16-8-11(15)14-7-10(13)6-12(3,4)5/h9-10H,6-8H2,1-5H3,(H,14,15) |
| InChIKey | KMRGUJWCKCASST-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.78 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chloro-4,4-dimethylpentyl)-2-propan-2-yloxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloro-4,4-dimethylpentyl)-2-propan-2-yloxyacetamide?
The IUPAC name of N-(2-chloro-4,4-dimethylpentyl)-2-propan-2-yloxyacetamide (CID 107156914) is N-(2-chloro-4,4-dimethylpentyl)-2-propan-2-yloxyacetamide.
What is the SMILES notation for N-(2-chloro-4,4-dimethylpentyl)-2-propan-2-yloxyacetamide?
The canonical SMILES for N-(2-chloro-4,4-dimethylpentyl)-2-propan-2-yloxyacetamide is CC(C)OCC(=O)NCC(Cl)CC(C)(C)C.
What is the InChIKey of N-(2-chloro-4,4-dimethylpentyl)-2-propan-2-yloxyacetamide?
The InChIKey is KMRGUJWCKCASST-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24ClNO2/c1-9(2)16-8-11(15)14-7-10(13)6-12(3,4)5/h9-10H,6-8H2,1-5H3,(H,14,15).
What are the key properties of N-(2-chloro-4,4-dimethylpentyl)-2-propan-2-yloxyacetamide?
N-(2-chloro-4,4-dimethylpentyl)-2-propan-2-yloxyacetamide has a molecular weight of 249.78 g/mol, XLogP of 2.57, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloro-4,4-dimethylpentyl)-2-propan-2-yloxyacetamide is sourced from PubChem (CID 107156914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).