C17H25N3O — CID 107159174
1-N-(6-methoxyisoquinolin-1-yl)-4,4-dimethylpentane-1,2-diamine (PubChem CID 107159174) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 1-N-(6-methoxyisoquinolin-1-yl)-4,4-dimethylpentane-1,2-diamine.
| Compound Name | 1-N-(6-methoxyisoquinolin-1-yl)-4,4-dimethylpentane-1,2-diamine |
|---|---|
| PubChem CID | 107159174 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 1-N-(6-methoxyisoquinolin-1-yl)-4,4-dimethylpentane-1,2-diamine |
| SMILES | COc1ccc2c(NCC(N)CC(C)(C)C)nccc2c1 |
| InChI | InChI=1S/C17H25N3O/c1-17(2,3)10-13(18)11-20-16-15-6-5-14(21-4)9-12(15)7-8-19-16/h5-9,13H,10-11,18H2,1-4H3,(H,19,20) |
| InChIKey | PHJQRKSWTJVUEW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |