C17H24N2O2 — CID 106539008
1-[(6-methoxyisoquinolin-1-yl)amino]-2,4-dimethylpentan-2-ol (PubChem CID 106539008) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 1-[(6-methoxyisoquinolin-1-yl)amino]-2,4-dimethylpentan-2-ol.
| Compound Name | 1-[(6-methoxyisoquinolin-1-yl)amino]-2,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 106539008 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 1-[(6-methoxyisoquinolin-1-yl)amino]-2,4-dimethylpentan-2-ol |
| SMILES | COc1ccc2c(NCC(C)(O)CC(C)C)nccc2c1 |
| InChI | InChI=1S/C17H24N2O2/c1-12(2)10-17(3,20)11-19-16-15-6-5-14(21-4)9-13(15)7-8-18-16/h5-9,12,20H,10-11H2,1-4H3,(H,18,19) |
| InChIKey | HMZHBTJTKSFQAF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |