About 1-[(2-hydroxy-2,4-dimethylpentyl)amino]isoquinolin-7-ol
1-[(2-hydroxy-2,4-dimethylpentyl)amino]isoquinolin-7-ol (PubChem CID 106539005) has the molecular formula C16H22N2O2
and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-[(2-hydroxy-2,4-dimethylpentyl)amino]isoquinolin-7-ol.
Molecular Properties
| Compound Name | 1-[(2-hydroxy-2,4-dimethylpentyl)amino]isoquinolin-7-ol |
| PubChem CID | 106539005 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-[(2-hydroxy-2,4-dimethylpentyl)amino]isoquinolin-7-ol |
| SMILES | CC(C)CC(C)(O)CNc1nccc2ccc(O)cc12 |
| InChI | InChI=1S/C16H22N2O2/c1-11(2)9-16(3,20)10-18-15-14-8-13(19)5-4-12(14)6-7-17-15/h4-8,11,19-20H,9-10H2,1-3H3,(H,17,18) |
| InChIKey | JPYYZSZXQLTSMB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(2-hydroxy-2,4-dimethylpentyl)amino]isoquinolin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-hydroxy-2,4-dimethylpentyl)amino]isoquinolin-7-ol?
The IUPAC name of 1-[(2-hydroxy-2,4-dimethylpentyl)amino]isoquinolin-7-ol (CID 106539005) is 1-[(2-hydroxy-2,4-dimethylpentyl)amino]isoquinolin-7-ol.
What is the SMILES notation for 1-[(2-hydroxy-2,4-dimethylpentyl)amino]isoquinolin-7-ol?
The canonical SMILES for 1-[(2-hydroxy-2,4-dimethylpentyl)amino]isoquinolin-7-ol is CC(C)CC(C)(O)CNc1nccc2ccc(O)cc12.
What is the InChIKey of 1-[(2-hydroxy-2,4-dimethylpentyl)amino]isoquinolin-7-ol?
The InChIKey is JPYYZSZXQLTSMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O2/c1-11(2)9-16(3,20)10-18-15-14-8-13(19)5-4-12(14)6-7-17-15/h4-8,11,19-20H,9-10H2,1-3H3,(H,17,18).
What are the key properties of 1-[(2-hydroxy-2,4-dimethylpentyl)amino]isoquinolin-7-ol?
1-[(2-hydroxy-2,4-dimethylpentyl)amino]isoquinolin-7-ol has a molecular weight of 274.36 g/mol, XLogP of 3.15, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-hydroxy-2,4-dimethylpentyl)amino]isoquinolin-7-ol is sourced from PubChem (CID 106539005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).