C7H17N3O2S — CID 107160182
4-(aminomethyl)-4-methylpiperidine-1-sulfonamide (PubChem CID 107160182) has the molecular formula C7H17N3O2S and a molecular weight of 207.30 g/mol. Its IUPAC name is 4-(aminomethyl)-4-methylpiperidine-1-sulfonamide.
| Compound Name | 4-(aminomethyl)-4-methylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 107160182 |
| Molecular Formula | C7H17N3O2S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 4-(aminomethyl)-4-methylpiperidine-1-sulfonamide |
| SMILES | CC1(CN)CCN(S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C7H17N3O2S/c1-7(6-8)2-4-10(5-3-7)13(9,11)12/h2-6,8H2,1H3,(H2,9,11,12) |
| InChIKey | CFQULUPVLKPKNE-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |