C14H18FN3OS — CID 107161223
4-carbamothioyl-N-(4-fluorophenyl)-4-methylpiperidine-1-carboxamide (PubChem CID 107161223) has the molecular formula C14H18FN3OS and a molecular weight of 295.38 g/mol. Its IUPAC name is 4-carbamothioyl-N-(4-fluorophenyl)-4-methylpiperidine-1-carboxamide.
| Compound Name | 4-carbamothioyl-N-(4-fluorophenyl)-4-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 107161223 |
| Molecular Formula | C14H18FN3OS |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 4-carbamothioyl-N-(4-fluorophenyl)-4-methylpiperidine-1-carboxamide |
| SMILES | CC1(C(N)=S)CCN(C(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C14H18FN3OS/c1-14(12(16)20)6-8-18(9-7-14)13(19)17-11-4-2-10(15)3-5-11/h2-5H,6-9H2,1H3,(H2,16,20)(H,17,19) |
| InChIKey | MDUGXJLVPXOJCN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|