C15H26ClN5 — CID 107162069
1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-4-methylpiperidine-4-carboximidamide (PubChem CID 107162069) has the molecular formula C15H26ClN5 and a molecular weight of 311.86 g/mol. Its IUPAC name is 1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-4-methylpiperidine-4-carboximidamide.
| Compound Name | 1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-4-methylpiperidine-4-carboximidamide |
|---|---|
| PubChem CID | 107162069 |
| Molecular Formula | C15H26ClN5 |
| Molecular Weight | 311.86 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-4-methylpiperidine-4-carboximidamide |
| SMILES | [H]/N=C(\N)C1(C)CCN(Cc2c(Cl)c(CC)nn2CC)CC1 |
| InChI | InChI=1S/C15H26ClN5/c1-4-11-13(16)12(21(5-2)19-11)10-20-8-6-15(3,7-9-20)14(17)18/h4-10H2,1-3H3,(H3,17,18) |
| InChIKey | NKFLXYAKAXTQBB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.86 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|