About 1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-4-methylpiperidine-4-carboximidamide
1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-4-methylpiperidine-4-carboximidamide (PubChem CID 107162109) has the molecular formula C15H26BrN5
and a molecular weight of 356.31 g/mol. Its IUPAC name is 1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-4-methylpiperidine-4-carboximidamide.
Molecular Properties
| Compound Name | 1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-4-methylpiperidine-4-carboximidamide |
| PubChem CID | 107162109 |
| Molecular Formula | C15H26BrN5 |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-4-methylpiperidine-4-carboximidamide |
| SMILES | [H]/N=C(\N)C1(C)CCN(Cc2c(Br)c(CC)nn2CC)CC1 |
| InChI | InChI=1S/C15H26BrN5/c1-4-11-13(16)12(21(5-2)19-11)10-20-8-6-15(3,7-9-20)14(17)18/h4-10H2,1-3H3,(H3,17,18) |
| InChIKey | NHIWOCCXFLQQEN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-4-methylpiperidine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-4-methylpiperidine-4-carboximidamide?
The IUPAC name of 1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-4-methylpiperidine-4-carboximidamide (CID 107162109) is 1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-4-methylpiperidine-4-carboximidamide.
What is the SMILES notation for 1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-4-methylpiperidine-4-carboximidamide?
The canonical SMILES for 1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-4-methylpiperidine-4-carboximidamide is [H]/N=C(\N)C1(C)CCN(Cc2c(Br)c(CC)nn2CC)CC1.
What is the InChIKey of 1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-4-methylpiperidine-4-carboximidamide?
The InChIKey is NHIWOCCXFLQQEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26BrN5/c1-4-11-13(16)12(21(5-2)19-11)10-20-8-6-15(3,7-9-20)14(17)18/h4-10H2,1-3H3,(H3,17,18).
What are the key properties of 1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-4-methylpiperidine-4-carboximidamide?
1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-4-methylpiperidine-4-carboximidamide has a molecular weight of 356.31 g/mol, XLogP of 2.77, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-4-methylpiperidine-4-carboximidamide is sourced from PubChem (CID 107162109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).