C14H24BrN5O — CID 107161822
1-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]-N'-hydroxy-4-methylpiperidine-4-carboximidamide (PubChem CID 107161822) has the molecular formula C14H24BrN5O and a molecular weight of 358.28 g/mol. Its IUPAC name is 1-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]-N'-hydroxy-4-methylpiperidine-4-carboximidamide.
| Compound Name | 1-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]-N'-hydroxy-4-methylpiperidine-4-carboximidamide |
|---|---|
| PubChem CID | 107161822 |
| Molecular Formula | C14H24BrN5O |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 1-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]-N'-hydroxy-4-methylpiperidine-4-carboximidamide |
| SMILES | CCc1nn(C)c(CN2CCC(C)(C(N)=NO)CC2)c1Br |
| InChI | InChI=1S/C14H24BrN5O/c1-4-10-12(15)11(19(3)17-10)9-20-7-5-14(2,6-8-20)13(16)18-21/h21H,4-9H2,1-3H3,(H2,16,18) |
| InChIKey | LFDLZCCALGAPQX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|