C14H23BrN4S — CID 107161541
1-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]-4-methylpiperidine-4-carbothioamide (PubChem CID 107161541) has the molecular formula C14H23BrN4S and a molecular weight of 359.34 g/mol. Its IUPAC name is 1-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]-4-methylpiperidine-4-carbothioamide.
| Compound Name | 1-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]-4-methylpiperidine-4-carbothioamide |
|---|---|
| PubChem CID | 107161541 |
| Molecular Formula | C14H23BrN4S |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 1-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]-4-methylpiperidine-4-carbothioamide |
| SMILES | CCc1nn(C)c(CN2CCC(C)(C(N)=S)CC2)c1Br |
| InChI | InChI=1S/C14H23BrN4S/c1-4-10-12(15)11(18(3)17-10)9-19-7-5-14(2,6-8-19)13(16)20/h4-9H2,1-3H3,(H2,16,20) |
| InChIKey | IDEALQNXYZLVOK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|