C13H19N3O3 — CID 107162414
N'-hydroxy-4-methyl-1-(5-methylfuran-2-carbonyl)piperidine-4-carboximidamide (PubChem CID 107162414) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is N'-hydroxy-4-methyl-1-(5-methylfuran-2-carbonyl)piperidine-4-carboximidamide.
| Compound Name | N'-hydroxy-4-methyl-1-(5-methylfuran-2-carbonyl)piperidine-4-carboximidamide |
|---|---|
| PubChem CID | 107162414 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | N'-hydroxy-4-methyl-1-(5-methylfuran-2-carbonyl)piperidine-4-carboximidamide |
| SMILES | Cc1ccc(C(=O)N2CCC(C)(/C(N)=N/O)CC2)o1 |
| InChI | InChI=1S/C13H19N3O3/c1-9-3-4-10(19-9)11(17)16-7-5-13(2,6-8-16)12(14)15-18/h3-4,18H,5-8H2,1-2H3,(H2,14,15) |
| InChIKey | YCHIUFFTTWTRDK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 92.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|