C14H17Cl2N3O2 — CID 107162411
1-(2,6-dichlorobenzoyl)-N'-hydroxy-4-methylpiperidine-4-carboximidamide (PubChem CID 107162411) has the molecular formula C14H17Cl2N3O2 and a molecular weight of 330.21 g/mol. Its IUPAC name is 1-(2,6-dichlorobenzoyl)-N'-hydroxy-4-methylpiperidine-4-carboximidamide.
| Compound Name | 1-(2,6-dichlorobenzoyl)-N'-hydroxy-4-methylpiperidine-4-carboximidamide |
|---|---|
| PubChem CID | 107162411 |
| Molecular Formula | C14H17Cl2N3O2 |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 1-(2,6-dichlorobenzoyl)-N'-hydroxy-4-methylpiperidine-4-carboximidamide |
| SMILES | CC1(/C(N)=N/O)CCN(C(=O)c2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C14H17Cl2N3O2/c1-14(13(17)18-21)5-7-19(8-6-14)12(20)11-9(15)3-2-4-10(11)16/h2-4,21H,5-8H2,1H3,(H2,17,18) |
| InChIKey | BRPYBBNPKMOICZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|