C14H30N2O3 — CID 107163780
1-[(1,4-dimethylpiperidin-4-yl)methylamino]-3-(2-methoxyethoxy)propan-2-ol (PubChem CID 107163780) has the molecular formula C14H30N2O3 and a molecular weight of 274.40 g/mol. Its IUPAC name is 1-[(1,4-dimethylpiperidin-4-yl)methylamino]-3-(2-methoxyethoxy)propan-2-ol.
| Compound Name | 1-[(1,4-dimethylpiperidin-4-yl)methylamino]-3-(2-methoxyethoxy)propan-2-ol |
|---|---|
| PubChem CID | 107163780 |
| Molecular Formula | C14H30N2O3 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | 1-[(1,4-dimethylpiperidin-4-yl)methylamino]-3-(2-methoxyethoxy)propan-2-ol |
| SMILES | COCCOCC(O)CNCC1(C)CCN(C)CC1 |
| InChI | InChI=1S/C14H30N2O3/c1-14(4-6-16(2)7-5-14)12-15-10-13(17)11-19-9-8-18-3/h13,15,17H,4-12H2,1-3H3 |
| InChIKey | BASUKLNBQDIGOV-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|