C16H21ClIN3 — CID 107164719
2-(chloromethyl)-1-[(1,4-dimethylpiperidin-4-yl)methyl]-5-iodobenzimidazole (PubChem CID 107164719) has the molecular formula C16H21ClIN3 and a molecular weight of 417.72 g/mol. Its IUPAC name is 2-(chloromethyl)-1-[(1,4-dimethylpiperidin-4-yl)methyl]-5-iodobenzimidazole.
| Compound Name | 2-(chloromethyl)-1-[(1,4-dimethylpiperidin-4-yl)methyl]-5-iodobenzimidazole |
|---|---|
| PubChem CID | 107164719 |
| Molecular Formula | C16H21ClIN3 |
| Molecular Weight | 417.72 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | 2-(chloromethyl)-1-[(1,4-dimethylpiperidin-4-yl)methyl]-5-iodobenzimidazole |
| SMILES | CN1CCC(C)(Cn2c(CCl)nc3cc(I)ccc32)CC1 |
| InChI | InChI=1S/C16H21ClIN3/c1-16(5-7-20(2)8-6-16)11-21-14-4-3-12(18)9-13(14)19-15(21)10-17/h3-4,9H,5-8,10-11H2,1-2H3 |
| InChIKey | UOVUSJSAXBEKCZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.72 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|