C13H17BrF3NS — CID 107167232
N-[1-(4-bromothiophen-2-yl)ethyl]-4-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 107167232) has the molecular formula C13H17BrF3NS and a molecular weight of 356.25 g/mol. Its IUPAC name is N-[1-(4-bromothiophen-2-yl)ethyl]-4-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | N-[1-(4-bromothiophen-2-yl)ethyl]-4-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 107167232 |
| Molecular Formula | C13H17BrF3NS |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | N-[1-(4-bromothiophen-2-yl)ethyl]-4-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | CC(NC1CCC(C(F)(F)F)CC1)c1cc(Br)cs1 |
| InChI | InChI=1S/C13H17BrF3NS/c1-8(12-6-10(14)7-19-12)18-11-4-2-9(3-5-11)13(15,16)17/h6-9,11,18H,2-5H2,1H3 |
| InChIKey | NXCDHHCFKWUVLR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |