C12H20BrNOS — CID 107167370
3-[[1-(4-bromothiophen-2-yl)ethylamino]methyl]pentan-3-ol (PubChem CID 107167370) has the molecular formula C12H20BrNOS and a molecular weight of 306.27 g/mol. Its IUPAC name is 3-[[1-(4-bromothiophen-2-yl)ethylamino]methyl]pentan-3-ol.
| Compound Name | 3-[[1-(4-bromothiophen-2-yl)ethylamino]methyl]pentan-3-ol |
|---|---|
| PubChem CID | 107167370 |
| Molecular Formula | C12H20BrNOS |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 3-[[1-(4-bromothiophen-2-yl)ethylamino]methyl]pentan-3-ol |
| SMILES | CCC(O)(CC)CNC(C)c1cc(Br)cs1 |
| InChI | InChI=1S/C12H20BrNOS/c1-4-12(15,5-2)8-14-9(3)11-6-10(13)7-16-11/h6-7,9,14-15H,4-5,8H2,1-3H3 |
| InChIKey | RPWJHYSVSNJWDL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |