C8H13F2NO2 — CID 107168162
N-(2-but-3-enoxyethyl)-2,2-difluoroacetamide (PubChem CID 107168162) has the molecular formula C8H13F2NO2 and a molecular weight of 193.19 g/mol. Its IUPAC name is N-(2-but-3-enoxyethyl)-2,2-difluoroacetamide.
| Compound Name | N-(2-but-3-enoxyethyl)-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 107168162 |
| Molecular Formula | C8H13F2NO2 |
| Molecular Weight | 193.19 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | N-(2-but-3-enoxyethyl)-2,2-difluoroacetamide |
| SMILES | C=CCCOCCNC(=O)C(F)F |
| InChI | InChI=1S/C8H13F2NO2/c1-2-3-5-13-6-4-11-8(12)7(9)10/h2,7H,1,3-6H2,(H,11,12) |
| InChIKey | ZNTBXXDEPUOYRX-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.19 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|