C17H15F2NO — CID 107170200
3-[5-fluoro-2-[(3-fluoro-4-methylphenoxy)methyl]phenyl]prop-2-yn-1-amine (PubChem CID 107170200) has the molecular formula C17H15F2NO and a molecular weight of 287.31 g/mol. Its IUPAC name is 3-[5-fluoro-2-[(3-fluoro-4-methylphenoxy)methyl]phenyl]prop-2-yn-1-amine.
| Compound Name | 3-[5-fluoro-2-[(3-fluoro-4-methylphenoxy)methyl]phenyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 107170200 |
| Molecular Formula | C17H15F2NO |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 3-[5-fluoro-2-[(3-fluoro-4-methylphenoxy)methyl]phenyl]prop-2-yn-1-amine |
| SMILES | Cc1ccc(OCc2ccc(F)cc2C#CCN)cc1F |
| InChI | InChI=1S/C17H15F2NO/c1-12-4-7-16(10-17(12)19)21-11-14-5-6-15(18)9-13(14)3-2-8-20/h4-7,9-10H,8,11,20H2,1H3 |
| InChIKey | LPFBHPDIHDEWOF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|