C16H12F3NO — CID 65201829
3-[4-[(2,5-difluorophenyl)methoxy]-2-fluorophenyl]prop-2-yn-1-amine (PubChem CID 65201829) has the molecular formula C16H12F3NO and a molecular weight of 291.27 g/mol. Its IUPAC name is 3-[4-[(2,5-difluorophenyl)methoxy]-2-fluorophenyl]prop-2-yn-1-amine.
| Compound Name | 3-[4-[(2,5-difluorophenyl)methoxy]-2-fluorophenyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 65201829 |
| Molecular Formula | C16H12F3NO |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 3-[4-[(2,5-difluorophenyl)methoxy]-2-fluorophenyl]prop-2-yn-1-amine |
| SMILES | NCC#Cc1ccc(OCc2cc(F)ccc2F)cc1F |
| InChI | InChI=1S/C16H12F3NO/c17-13-4-6-15(18)12(8-13)10-21-14-5-3-11(2-1-7-20)16(19)9-14/h3-6,8-9H,7,10,20H2 |
| InChIKey | OPFBGAAPCRJJNX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|