C11H10FN3O2 — CID 107171900
5-amino-4-(3-fluoro-4-methylphenoxy)-1H-pyrimidin-6-one (PubChem CID 107171900) has the molecular formula C11H10FN3O2 and a molecular weight of 235.22 g/mol. Its IUPAC name is 5-amino-4-(3-fluoro-4-methylphenoxy)-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-(3-fluoro-4-methylphenoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 107171900 |
| Molecular Formula | C11H10FN3O2 |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 5-amino-4-(3-fluoro-4-methylphenoxy)-1H-pyrimidin-6-one |
| SMILES | Cc1ccc(Oc2nc[nH]c(=O)c2N)cc1F |
| InChI | InChI=1S/C11H10FN3O2/c1-6-2-3-7(4-8(6)12)17-11-9(13)10(16)14-5-15-11/h2-5H,13H2,1H3,(H,14,15,16) |
| InChIKey | WIHIBADYRGOSJU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |