C16H22ClN3 — CID 107171927
N-[(6-chloro-1H-indol-3-yl)methyl]-N-methylazepan-4-amine (PubChem CID 107171927) has the molecular formula C16H22ClN3 and a molecular weight of 291.83 g/mol. Its IUPAC name is N-[(6-chloro-1H-indol-3-yl)methyl]-N-methylazepan-4-amine.
| Compound Name | N-[(6-chloro-1H-indol-3-yl)methyl]-N-methylazepan-4-amine |
|---|---|
| PubChem CID | 107171927 |
| Molecular Formula | C16H22ClN3 |
| Molecular Weight | 291.83 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | N-[(6-chloro-1H-indol-3-yl)methyl]-N-methylazepan-4-amine |
| SMILES | CN(Cc1c[nH]c2cc(Cl)ccc12)C1CCCNCC1 |
| InChI | InChI=1S/C16H22ClN3/c1-20(14-3-2-7-18-8-6-14)11-12-10-19-16-9-13(17)4-5-15(12)16/h4-5,9-10,14,18-19H,2-3,6-8,11H2,1H3 |
| InChIKey | KXFMPXJPFHRHFX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.83 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |