C15H22N4 — CID 107172040
N-methyl-N-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)azepan-4-amine (PubChem CID 107172040) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is N-methyl-N-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)azepan-4-amine.
| Compound Name | N-methyl-N-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)azepan-4-amine |
|---|---|
| PubChem CID | 107172040 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | N-methyl-N-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)azepan-4-amine |
| SMILES | CN(Cc1c[nH]c2ncccc12)C1CCCNCC1 |
| InChI | InChI=1S/C15H22N4/c1-19(13-4-2-7-16-9-6-13)11-12-10-18-15-14(12)5-3-8-17-15/h3,5,8,10,13,16H,2,4,6-7,9,11H2,1H3,(H,17,18) |
| InChIKey | VKTGTZRVRMWXDI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |