C13H16N4O — CID 66415273
3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)piperidin-2-one (PubChem CID 66415273) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)piperidin-2-one.
| Compound Name | 3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)piperidin-2-one |
|---|---|
| PubChem CID | 66415273 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)piperidin-2-one |
| SMILES | O=C1NCCCC1NCc1c[nH]c2ncccc12 |
| InChI | InChI=1S/C13H16N4O/c18-13-11(4-2-6-15-13)16-7-9-8-17-12-10(9)3-1-5-14-12/h1,3,5,8,11,16H,2,4,6-7H2,(H,14,17)(H,15,18) |
| InChIKey | BDDMMZVMJMMXEX-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |