About 1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)pyrrolidin-2-one
1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)pyrrolidin-2-one (PubChem CID 106252551) has the molecular formula C13H16N4O
and a molecular weight of 244.30 g/mol. Its IUPAC name is 1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)pyrrolidin-2-one |
| PubChem CID | 106252551 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)pyrrolidin-2-one |
| SMILES | CN1CCC(NCc2c[nH]c3ncccc23)C1=O |
| InChI | InChI=1S/C13H16N4O/c1-17-6-4-11(13(17)18)15-7-9-8-16-12-10(9)3-2-5-14-12/h2-3,5,8,11,15H,4,6-7H2,1H3,(H,14,16) |
| InChIKey | AVKVFKLIGZOKAI-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)pyrrolidin-2-one?
The IUPAC name of 1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)pyrrolidin-2-one (CID 106252551) is 1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)pyrrolidin-2-one.
What is the SMILES notation for 1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)pyrrolidin-2-one?
The canonical SMILES for 1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)pyrrolidin-2-one is CN1CCC(NCc2c[nH]c3ncccc23)C1=O.
What is the InChIKey of 1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)pyrrolidin-2-one?
The InChIKey is AVKVFKLIGZOKAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O/c1-17-6-4-11(13(17)18)15-7-9-8-16-12-10(9)3-2-5-14-12/h2-3,5,8,11,15H,4,6-7H2,1H3,(H,14,16).
What are the key properties of 1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)pyrrolidin-2-one?
1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)pyrrolidin-2-one has a molecular weight of 244.30 g/mol, XLogP of 0.88, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylamino)pyrrolidin-2-one is sourced from PubChem (CID 106252551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).