C14H18BrF3N2 — CID 107174118
N-[2-bromo-4-(trifluoromethyl)phenyl]-N-methylazepan-4-amine (PubChem CID 107174118) has the molecular formula C14H18BrF3N2 and a molecular weight of 351.21 g/mol. Its IUPAC name is N-[2-bromo-4-(trifluoromethyl)phenyl]-N-methylazepan-4-amine.
| Compound Name | N-[2-bromo-4-(trifluoromethyl)phenyl]-N-methylazepan-4-amine |
|---|---|
| PubChem CID | 107174118 |
| Molecular Formula | C14H18BrF3N2 |
| Molecular Weight | 351.21 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | N-[2-bromo-4-(trifluoromethyl)phenyl]-N-methylazepan-4-amine |
| SMILES | CN(c1ccc(C(F)(F)F)cc1Br)C1CCCNCC1 |
| InChI | InChI=1S/C14H18BrF3N2/c1-20(11-3-2-7-19-8-6-11)13-5-4-10(9-12(13)15)14(16,17)18/h4-5,9,11,19H,2-3,6-8H2,1H3 |
| InChIKey | BKNFTBDFUKBTTJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.21 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |