C14H19BrF3N3 — CID 115511896
2-bromo-N-methyl-N-(2-piperazin-1-ylethyl)-4-(trifluoromethyl)aniline (PubChem CID 115511896) has the molecular formula C14H19BrF3N3 and a molecular weight of 366.23 g/mol. Its IUPAC name is 2-bromo-N-methyl-N-(2-piperazin-1-ylethyl)-4-(trifluoromethyl)aniline.
| Compound Name | 2-bromo-N-methyl-N-(2-piperazin-1-ylethyl)-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 115511896 |
| Molecular Formula | C14H19BrF3N3 |
| Molecular Weight | 366.23 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 2-bromo-N-methyl-N-(2-piperazin-1-ylethyl)-4-(trifluoromethyl)aniline |
| SMILES | CN(CCN1CCNCC1)c1ccc(C(F)(F)F)cc1Br |
| InChI | InChI=1S/C14H19BrF3N3/c1-20(8-9-21-6-4-19-5-7-21)13-3-2-11(10-12(13)15)14(16,17)18/h2-3,10,19H,4-9H2,1H3 |
| InChIKey | UOQWXDFTRZTXOE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.23 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |