C17H21NO2 — CID 107176338
5-(2,2-dimethylcyclopentanecarbonyl)-1-methyl-3H-indol-2-one (PubChem CID 107176338) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 5-(2,2-dimethylcyclopentanecarbonyl)-1-methyl-3H-indol-2-one.
| Compound Name | 5-(2,2-dimethylcyclopentanecarbonyl)-1-methyl-3H-indol-2-one |
|---|---|
| PubChem CID | 107176338 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 5-(2,2-dimethylcyclopentanecarbonyl)-1-methyl-3H-indol-2-one |
| SMILES | CN1C(=O)Cc2cc(C(=O)C3CCCC3(C)C)ccc21 |
| InChI | InChI=1S/C17H21NO2/c1-17(2)8-4-5-13(17)16(20)11-6-7-14-12(9-11)10-15(19)18(14)3/h6-7,9,13H,4-5,8,10H2,1-3H3 |
| InChIKey | RZFGQXPLVKWOSL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |