C13H17F2N — CID 107177000
(2,4-difluorophenyl)-(2-methylcyclopentyl)methanamine (PubChem CID 107177000) has the molecular formula C13H17F2N and a molecular weight of 225.28 g/mol. Its IUPAC name is (2,4-difluorophenyl)-(2-methylcyclopentyl)methanamine.
| Compound Name | (2,4-difluorophenyl)-(2-methylcyclopentyl)methanamine |
|---|---|
| PubChem CID | 107177000 |
| Molecular Formula | C13H17F2N |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | (2,4-difluorophenyl)-(2-methylcyclopentyl)methanamine |
| SMILES | CC1CCCC1C(N)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H17F2N/c1-8-3-2-4-10(8)13(16)11-6-5-9(14)7-12(11)15/h5-8,10,13H,2-4,16H2,1H3 |
| InChIKey | AEQCOAPBRWXBTI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |