C15H22F2N2 — CID 107520774
1-(2,4-difluorophenyl)-2-(2,3-dimethylpiperidin-1-yl)ethanamine (PubChem CID 107520774) has the molecular formula C15H22F2N2 and a molecular weight of 268.35 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-(2,3-dimethylpiperidin-1-yl)ethanamine.
| Compound Name | 1-(2,4-difluorophenyl)-2-(2,3-dimethylpiperidin-1-yl)ethanamine |
|---|---|
| PubChem CID | 107520774 |
| Molecular Formula | C15H22F2N2 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-(2,3-dimethylpiperidin-1-yl)ethanamine |
| SMILES | CC1CCCN(CC(N)c2ccc(F)cc2F)C1C |
| InChI | InChI=1S/C15H22F2N2/c1-10-4-3-7-19(11(10)2)9-15(18)13-6-5-12(16)8-14(13)17/h5-6,8,10-11,15H,3-4,7,9,18H2,1-2H3 |
| InChIKey | HTLCHCOOZQSCFJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |