C17H24F2N2 — CID 107522127
2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-1-(2,5-difluorophenyl)ethanamine (PubChem CID 107522127) has the molecular formula C17H24F2N2 and a molecular weight of 294.39 g/mol. Its IUPAC name is 2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-1-(2,5-difluorophenyl)ethanamine.
| Compound Name | 2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-1-(2,5-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 107522127 |
| Molecular Formula | C17H24F2N2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-1-(2,5-difluorophenyl)ethanamine |
| SMILES | NC(CN1CCC[C@H]2CCCC[C@H]21)c1cc(F)ccc1F |
| InChI | InChI=1S/C17H24F2N2/c18-13-7-8-15(19)14(10-13)16(20)11-21-9-3-5-12-4-1-2-6-17(12)21/h7-8,10,12,16-17H,1-6,9,11,20H2/t12-,16?,17-/m1/s1 |
| InChIKey | RRJJDHZCXGXHBZ-SCWIMFDPSA-N |
| XLogP | 3.62 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |