C17H28N2O — CID 62122834
2-(2,3-dimethylpiperidin-1-yl)-1-(2-ethoxyphenyl)ethanamine (PubChem CID 62122834) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is 2-(2,3-dimethylpiperidin-1-yl)-1-(2-ethoxyphenyl)ethanamine.
| Compound Name | 2-(2,3-dimethylpiperidin-1-yl)-1-(2-ethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 62122834 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 2-(2,3-dimethylpiperidin-1-yl)-1-(2-ethoxyphenyl)ethanamine |
| SMILES | CCOc1ccccc1C(N)CN1CCCC(C)C1C |
| InChI | InChI=1S/C17H28N2O/c1-4-20-17-10-6-5-9-15(17)16(18)12-19-11-7-8-13(2)14(19)3/h5-6,9-10,13-14,16H,4,7-8,11-12,18H2,1-3H3 |
| InChIKey | DHSFFCAYTAQLNB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |