C12H19NO — CID 107178330
N-(furan-2-ylmethyl)-1-(2-methylcyclopentyl)methanamine (PubChem CID 107178330) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1-(2-methylcyclopentyl)methanamine.
| Compound Name | N-(furan-2-ylmethyl)-1-(2-methylcyclopentyl)methanamine |
|---|---|
| PubChem CID | 107178330 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | N-(furan-2-ylmethyl)-1-(2-methylcyclopentyl)methanamine |
| SMILES | CC1CCCC1CNCc1ccco1 |
| InChI | InChI=1S/C12H19NO/c1-10-4-2-5-11(10)8-13-9-12-6-3-7-14-12/h3,6-7,10-11,13H,2,4-5,8-9H2,1H3 |
| InChIKey | KAVFRJQRXXEHBX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |