C15H28N2OS — CID 107178691
N-(3-amino-3-sulfanylidenepropyl)-2,2-dimethyl-N-propan-2-ylcyclohexane-1-carboxamide (PubChem CID 107178691) has the molecular formula C15H28N2OS and a molecular weight of 284.47 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-2,2-dimethyl-N-propan-2-ylcyclohexane-1-carboxamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-2,2-dimethyl-N-propan-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 107178691 |
| Molecular Formula | C15H28N2OS |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-2,2-dimethyl-N-propan-2-ylcyclohexane-1-carboxamide |
| SMILES | CC(C)N(CCC(N)=S)C(=O)C1CCCCC1(C)C |
| InChI | InChI=1S/C15H28N2OS/c1-11(2)17(10-8-13(16)19)14(18)12-7-5-6-9-15(12,3)4/h11-12H,5-10H2,1-4H3,(H2,16,19) |
| InChIKey | QENFITSRMSKLQP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|