C12H21N3 — CID 107179282
5-(2-methylcyclopentyl)-4-propan-2-yl-1H-pyrazol-3-amine (PubChem CID 107179282) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 5-(2-methylcyclopentyl)-4-propan-2-yl-1H-pyrazol-3-amine.
| Compound Name | 5-(2-methylcyclopentyl)-4-propan-2-yl-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 107179282 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 5-(2-methylcyclopentyl)-4-propan-2-yl-1H-pyrazol-3-amine |
| SMILES | CC(C)c1c(N)n[nH]c1C1CCCC1C |
| InChI | InChI=1S/C12H21N3/c1-7(2)10-11(14-15-12(10)13)9-6-4-5-8(9)3/h7-9H,4-6H2,1-3H3,(H3,13,14,15) |
| InChIKey | SRYZMLQXHPHGLC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |