C13H18OS — CID 107179308
1-(2,2-dimethylcyclopentyl)-2-thiophen-2-ylethanone (PubChem CID 107179308) has the molecular formula C13H18OS and a molecular weight of 222.35 g/mol. Its IUPAC name is 1-(2,2-dimethylcyclopentyl)-2-thiophen-2-ylethanone.
| Compound Name | 1-(2,2-dimethylcyclopentyl)-2-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 107179308 |
| Molecular Formula | C13H18OS |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 1-(2,2-dimethylcyclopentyl)-2-thiophen-2-ylethanone |
| SMILES | CC1(C)CCCC1C(=O)Cc1cccs1 |
| InChI | InChI=1S/C13H18OS/c1-13(2)7-3-6-11(13)12(14)9-10-5-4-8-15-10/h4-5,8,11H,3,6-7,9H2,1-2H3 |
| InChIKey | ZHDCBUJJPFRDNX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |