C10H17N3S — CID 107180069
5-(2,2-dimethylcyclohexyl)-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 107180069) has the molecular formula C10H17N3S and a molecular weight of 211.33 g/mol. Its IUPAC name is 5-(2,2-dimethylcyclohexyl)-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-(2,2-dimethylcyclohexyl)-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 107180069 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 5-(2,2-dimethylcyclohexyl)-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | CC1(C)CCCCC1c1nc(=S)[nH][nH]1 |
| InChI | InChI=1S/C10H17N3S/c1-10(2)6-4-3-5-7(10)8-11-9(14)13-12-8/h7H,3-6H2,1-2H3,(H2,11,12,13,14) |
| InChIKey | CHZCTPICLULEDD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|