C13H15BrN2 — CID 107180157
6-bromo-2-(2-methylcyclopentyl)-1H-benzimidazole (PubChem CID 107180157) has the molecular formula C13H15BrN2 and a molecular weight of 279.18 g/mol. Its IUPAC name is 6-bromo-2-(2-methylcyclopentyl)-1H-benzimidazole.
| Compound Name | 6-bromo-2-(2-methylcyclopentyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 107180157 |
| Molecular Formula | C13H15BrN2 |
| Molecular Weight | 279.18 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 6-bromo-2-(2-methylcyclopentyl)-1H-benzimidazole |
| SMILES | CC1CCCC1c1nc2ccc(Br)cc2[nH]1 |
| InChI | InChI=1S/C13H15BrN2/c1-8-3-2-4-10(8)13-15-11-6-5-9(14)7-12(11)16-13/h5-8,10H,2-4H2,1H3,(H,15,16) |
| InChIKey | UHKRGJSXXQVBKE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.18 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |