C13H15ClN2 — CID 107180152
4-chloro-2-(2-methylcyclopentyl)-1H-benzimidazole (PubChem CID 107180152) has the molecular formula C13H15ClN2 and a molecular weight of 234.73 g/mol. Its IUPAC name is 4-chloro-2-(2-methylcyclopentyl)-1H-benzimidazole.
| Compound Name | 4-chloro-2-(2-methylcyclopentyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 107180152 |
| Molecular Formula | C13H15ClN2 |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 4-chloro-2-(2-methylcyclopentyl)-1H-benzimidazole |
| SMILES | CC1CCCC1c1nc2c(Cl)cccc2[nH]1 |
| InChI | InChI=1S/C13H15ClN2/c1-8-4-2-5-9(8)13-15-11-7-3-6-10(14)12(11)16-13/h3,6-9H,2,4-5H2,1H3,(H,15,16) |
| InChIKey | RZBKQLRDWODGHA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |