C15H18BrClO2 — CID 107182053
6-bromo-7-[chloro-(2-methylcyclopentyl)methyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 107182053) has the molecular formula C15H18BrClO2 and a molecular weight of 345.66 g/mol. Its IUPAC name is 6-bromo-7-[chloro-(2-methylcyclopentyl)methyl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-bromo-7-[chloro-(2-methylcyclopentyl)methyl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 107182053 |
| Molecular Formula | C15H18BrClO2 |
| Molecular Weight | 345.66 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 6-bromo-7-[chloro-(2-methylcyclopentyl)methyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | CC1CCCC1C(Cl)c1cc2c(cc1Br)OCCO2 |
| InChI | InChI=1S/C15H18BrClO2/c1-9-3-2-4-10(9)15(17)11-7-13-14(8-12(11)16)19-6-5-18-13/h7-10,15H,2-6H2,1H3 |
| InChIKey | NYPCXQYRJVBWLE-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.66 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|