C17H22BrNO — CID 107182391
6-[bromo-(2-methylcyclopentyl)methyl]-1-methyl-3,4-dihydroquinolin-2-one (PubChem CID 107182391) has the molecular formula C17H22BrNO and a molecular weight of 336.27 g/mol. Its IUPAC name is 6-[bromo-(2-methylcyclopentyl)methyl]-1-methyl-3,4-dihydroquinolin-2-one.
| Compound Name | 6-[bromo-(2-methylcyclopentyl)methyl]-1-methyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 107182391 |
| Molecular Formula | C17H22BrNO |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 6-[bromo-(2-methylcyclopentyl)methyl]-1-methyl-3,4-dihydroquinolin-2-one |
| SMILES | CC1CCCC1C(Br)c1ccc2c(c1)CCC(=O)N2C |
| InChI | InChI=1S/C17H22BrNO/c1-11-4-3-5-14(11)17(18)13-6-8-15-12(10-13)7-9-16(20)19(15)2/h6,8,10-11,14,17H,3-5,7,9H2,1-2H3 |
| InChIKey | LHAILRPTIRWQGS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|