C13H12Cl2N2OS — CID 107183624
5-amino-2,3-dichloro-N-(1-thiophen-2-ylethyl)benzamide (PubChem CID 107183624) has the molecular formula C13H12Cl2N2OS and a molecular weight of 315.23 g/mol. Its IUPAC name is 5-amino-2,3-dichloro-N-(1-thiophen-2-ylethyl)benzamide.
| Compound Name | 5-amino-2,3-dichloro-N-(1-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 107183624 |
| Molecular Formula | C13H12Cl2N2OS |
| Molecular Weight | 315.23 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 5-amino-2,3-dichloro-N-(1-thiophen-2-ylethyl)benzamide |
| SMILES | CC(NC(=O)c1cc(N)cc(Cl)c1Cl)c1cccs1 |
| InChI | InChI=1S/C13H12Cl2N2OS/c1-7(11-3-2-4-19-11)17-13(18)9-5-8(16)6-10(14)12(9)15/h2-7H,16H2,1H3,(H,17,18) |
| InChIKey | HLPNRJREFIWLMB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.23 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|