C13H13Cl2N3OS — CID 107185774
5-amino-2,3-dichloro-N-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]benzamide (PubChem CID 107185774) has the molecular formula C13H13Cl2N3OS and a molecular weight of 330.24 g/mol. Its IUPAC name is 5-amino-2,3-dichloro-N-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]benzamide.
| Compound Name | 5-amino-2,3-dichloro-N-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 107185774 |
| Molecular Formula | C13H13Cl2N3OS |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | 5-amino-2,3-dichloro-N-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]benzamide |
| SMILES | Cc1cnc(C(C)NC(=O)c2cc(N)cc(Cl)c2Cl)s1 |
| InChI | InChI=1S/C13H13Cl2N3OS/c1-6-5-17-13(20-6)7(2)18-12(19)9-3-8(16)4-10(14)11(9)15/h3-5,7H,16H2,1-2H3,(H,18,19) |
| InChIKey | MILNBIVQHRKIOE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|