C16H28N2O — CID 107185133
N-[2-[5-(2,2-dimethylcyclohexyl)-1,3-oxazol-2-yl]ethyl]propan-1-amine (PubChem CID 107185133) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is N-[2-[5-(2,2-dimethylcyclohexyl)-1,3-oxazol-2-yl]ethyl]propan-1-amine.
| Compound Name | N-[2-[5-(2,2-dimethylcyclohexyl)-1,3-oxazol-2-yl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 107185133 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | N-[2-[5-(2,2-dimethylcyclohexyl)-1,3-oxazol-2-yl]ethyl]propan-1-amine |
| SMILES | CCCNCCc1ncc(C2CCCCC2(C)C)o1 |
| InChI | InChI=1S/C16H28N2O/c1-4-10-17-11-8-15-18-12-14(19-15)13-7-5-6-9-16(13,2)3/h12-13,17H,4-11H2,1-3H3 |
| InChIKey | FKUUENRLBGGBIX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|