C17H30N2O — CID 107185194
N-[3-[5-(2,2-dimethylcyclopentyl)-1,3-oxazol-2-yl]propyl]-2-methylpropan-1-amine (PubChem CID 107185194) has the molecular formula C17H30N2O and a molecular weight of 278.44 g/mol. Its IUPAC name is N-[3-[5-(2,2-dimethylcyclopentyl)-1,3-oxazol-2-yl]propyl]-2-methylpropan-1-amine.
| Compound Name | N-[3-[5-(2,2-dimethylcyclopentyl)-1,3-oxazol-2-yl]propyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 107185194 |
| Molecular Formula | C17H30N2O |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | N-[3-[5-(2,2-dimethylcyclopentyl)-1,3-oxazol-2-yl]propyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCCCc1ncc(C2CCCC2(C)C)o1 |
| InChI | InChI=1S/C17H30N2O/c1-13(2)11-18-10-6-8-16-19-12-15(20-16)14-7-5-9-17(14,3)4/h12-14,18H,5-11H2,1-4H3 |
| InChIKey | CTHQZMYIBOQJOA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|