C15H26N2O — CID 66478580
N-ethyl-3-[5-(2,2,3,3-tetramethylcyclopropyl)-1,3-oxazol-2-yl]propan-1-amine (PubChem CID 66478580) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is N-ethyl-3-[5-(2,2,3,3-tetramethylcyclopropyl)-1,3-oxazol-2-yl]propan-1-amine.
| Compound Name | N-ethyl-3-[5-(2,2,3,3-tetramethylcyclopropyl)-1,3-oxazol-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 66478580 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | N-ethyl-3-[5-(2,2,3,3-tetramethylcyclopropyl)-1,3-oxazol-2-yl]propan-1-amine |
| SMILES | CCNCCCc1ncc(C2C(C)(C)C2(C)C)o1 |
| InChI | InChI=1S/C15H26N2O/c1-6-16-9-7-8-12-17-10-11(18-12)13-14(2,3)15(13,4)5/h10,13,16H,6-9H2,1-5H3 |
| InChIKey | IZFQGJHMNMAUPG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|