C12H8Cl3N3O — CID 107185676
5-amino-2,3-dichloro-N-(2-chloro-4-pyridinyl)benzamide (PubChem CID 107185676) has the molecular formula C12H8Cl3N3O and a molecular weight of 316.58 g/mol. Its IUPAC name is 5-amino-2,3-dichloro-N-(2-chloro-4-pyridinyl)benzamide.
| Compound Name | 5-amino-2,3-dichloro-N-(2-chloro-4-pyridinyl)benzamide |
|---|---|
| PubChem CID | 107185676 |
| Molecular Formula | C12H8Cl3N3O |
| Molecular Weight | 316.58 g/mol |
| Exact Mass | 314.97 |
| IUPAC Name | 5-amino-2,3-dichloro-N-(2-chloro-4-pyridinyl)benzamide |
| SMILES | Nc1cc(Cl)c(Cl)c(C(=O)Nc2ccnc(Cl)c2)c1 |
| InChI | InChI=1S/C12H8Cl3N3O/c13-9-4-6(16)3-8(11(9)15)12(19)18-7-1-2-17-10(14)5-7/h1-5H,16H2,(H,17,18,19) |
| InChIKey | MXGJJTYGHMIFNC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.58 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|